Dofetilide
Dofetilide is a potassium channel blocker that acts as a class III antiarrhythmic drug. It is used for the treatment of atrial fibrillation and flutter.
| Trivial name | UK-68798 |
| Catalog Number | CSN15735 |
| Alternative Name(s) | UK-68798 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C19H27N3O5S2 |
| CAS# | 115256-11-6 |
| Purity | ≥99% |
| SMILES | CS(=O)(NC1=CC=C(CCN(C)CCOC2=CC=C(NS(=O)(C)=O)C=C2)C=C1)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/dofetilide.html |
