Sakakin
Sakakin, a natural product isolated and purified from the rhizomes of Curculigo orchioides Gaertn, can improve depressive behaviour in chronic unpredictable mild stress (CUMS) rats by downregulating HPA axis hyperactivity and increasing BDNF expression and ERK1/2 phosphorylation in the hippocampus.
| Trivial name | Orcinol Glucoside |
| Catalog Number | CSN13112 |
| Alternative Name(s) | Orcinol Glucoside |
| Research Area | / |
| Molecular Formula | C13H18O7 |
| CAS# | 21082-33-7 |
| Purity | ≥99% |
| SMILES | O[C@H]1C(OC2=CC(C)=CC(O)=C2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/sakakin.html |