4-Methylumbelliferone
4-Methylumbelliferone, a natural product isolated and purified from the herbs of Ruta graveolens L., is a hyaluronic acid (HA) synthesis inhibitor with an IC50 of 0.4 mM.
| Trivial name | 4-MU |
| Catalog Number | CSN13076 |
| Alternative Name(s) | 4-MU |
| Research Area | / |
| Molecular Formula | C10H8O3 |
| CAS# | 90-33-5 |
| Purity | ≥99% |
| SMILES | O=C1C=C(C)C2=C(O1)C=C(O)C=C2 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/4-methylumbelliferone.html |
