Terazosin HCl
Terazosin HCl is a selective antagonist for alpha-adrenergic receptor, used for treatment for hypertension and prostate enlargement (BPH) through lowering the blood pressure with elimination half-life of 12 hours.
| Trivial name | Fosfomic HCl |
| Catalog Number | CSN12855 |
| Alternative Name(s) | Fosfomic HCl |
| Research Area | Metabolic Disease |
| Molecular Formula | C19H26ClN5O4 |
| CAS# | 63074-08-8 |
| Purity | ≥99% |
| SMILES | O=C(N1CCN(C2=NC(N)=C3C=C(OC)C(OC)=CC3=N2)CC1)C4OCCC4.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/terazosin-hcl.html |