Fenofibrate
Fenofibrate is an agonist of PPARα (EC50 = 30 μM) and an inhibitor of CYP2C19 (IC50 = 0.2 μM) and CYP2B6 (IC50 = 0.7 μM). Fenofibrate is a fibric acid derivative and used to treat hypercholesterolemia and hypertriglyceridemia.
| Trivial name | / |
| Catalog Number | CSN12680 |
| Alternative Name(s) | / |
| Research Area | Metabolic Disease |
| Molecular Formula | C20H21ClO4 |
| CAS# | 49562-28-9 |
| Purity | ≥99% |
| SMILES | CC(C)(OC1=CC=C(C(C2=CC=C(Cl)C=C2)=O)C=C1)C(OC(C)C)=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/fenofibrate.html |