Zileuton
Zileuton is a reversible 5-lipoxygenase inhibitor with IC50 value of 0.5 µM in rat basophilic leukemia-1 (RBL-1) cells. It also potently inhibited leukotriene B4 production with an IC50 value of 0.6 µM in purified human peripheral blood polymorphonuclear leukocytes (PMNL).
| Trivial name | A-64077 |
| Catalog Number | CSN12237 |
| Alternative Name(s) | A-64077 |
| Research Area | Immunology/Inflammation|Neurological Disease |
| Molecular Formula | C11H12N2O2S |
| CAS# | 111406-87-2 |
| Purity | ≥99% |
| SMILES | CC(N(O)C(N)=O)C1=CC2=CC=CC=C2S1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/zileuton.html |
