Xylometazoline HCl
Xylometazoline HCl a direct acting sympathomimetic adrenergic α-agonist, used to improve symptoms of nasal congestion, allergic rhinitis, and sinusitis with elimination half-life of >10 seconds.
| Trivial name | / |
| Catalog Number | CSN12225 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C10H11BrO2 |
| CAS# | 1218-35-5 |
| Purity | ≥99% |
| SMILES | CC1=C(C(C)=CC(C(C)(C)C)=C1)CC2=NCCN2.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/xylometazoline-hcl.html |
