Voriconazole
Voriconazole is a second-generation triazole antifungal used to treat serious fungal infections by inhibiting the synthesis of ergosterol, the major sterol of the fungal cell membrane.
| Trivial name | UK-109496 |
| Catalog Number | CSN12213 |
| Alternative Name(s) | UK-109496 |
| Research Area | Infection |
| Molecular Formula | C16H14F3N5O |
| CAS# | 137234-62-9 |
| Purity | ≥99% |
| SMILES | O[C@@]([C@@H](C)C1=NC=NC=C1F)(CN2N=CN=C2)C(C(F)=C3)=CC=C3F |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/voriconazole.html |
