Tyrphostin AG 879
Tyrphostin AG 879 potently inhibits HER2/ErbB2 with IC50 of 1 μM, 100- and 500-fold higher selective to ErbB2 than PDGFR and EGFR.
| Trivial name | AG 879 |
| Catalog Number | CSN12170 |
| Alternative Name(s) | AG 879 |
| Research Area | Cancer |
| Molecular Formula | C18H24N2OS |
| CAS# | 148741-30-4 |
| Purity | ≥99% |
| SMILES | S=C(N)/C(C#N)=C/C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/tyrphostin-ag-879.html |
