Kaempferitrin
Kaempferitrin can activate insulin signaling pathway, phosphorylate Akt kinase and exert the transloocation of GLUT4, thus has antitumor, antidepressant and antidiabetic effects. Kaempferitrin is a natural product isolated and purified from the root of Kaempferia galangal L..
| Trivial name | / |
| Catalog Number | CSN11241 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C27H30O14 |
| CAS# | 482-38-2 |
| Purity | ≥99% |
| SMILES | O=C1C(O[C@H](O[C@@H](C)[C@H](O)[C@H]2O)[C@@H]2O)=C(C3=CC=C(O)C=C3)OC4=CC(O[C@H](O[C@@H](C)[C@H](O)[C@H]5O)[C@@H]5O)=CC(O)=C14 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/kaempferitrin.html |