Glutathione
Glutathione acts as an antioxidant, a free radical scavenger and a detoxifying agent. It is a tripeptide comprised of three amino acids (cysteine, glutamic acid, and glycine) present in most mammalian tissue.
| Trivial name | L-Glutathione Reduced; 5-L-Glutamyl-L-cysteinylglycine; gamma-L-Glutamyl-L-cysteinyl-glycine |
| Catalog Number | CSN11120 |
| Alternative Name(s) | L-Glutathione Reduced; 5-L-Glutamyl-L-cysteinylglycine; gamma-L-Glutamyl-L-cysteinyl-glycine |
| Research Area | / |
| Molecular Formula | C10H17N3O6S |
| CAS# | 70-18-8 |
| Purity | ≥99% |
| SMILES | O=C(O)[C@@H](N)CCC(N[C@@H](CS)C(NCC(O)=O)=O)=O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/glutathione.html |