Diosmetin
Diosmetin is a bioflavonoid found in spearmint, oregano, and many other plants, and is an agonist of the aryl hydrocarbon receptor that differentially affect cytochrome P450 1A1 activity.
| Trivial name | Luteolin 4-Methyl Ether |
| Catalog Number | CSN10830 |
| Alternative Name(s) | Luteolin 4-Methyl Ether |
| Research Area | Cancer |
| Molecular Formula | C16H12O6 |
| CAS# | 520-34-3 |
| Purity | ≥99% |
| SMILES | COC1=C(O)C=C(C=C1)C1=CC(=O)C2=C(O)C=C(O)C=C2O1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/diosmetin.html |