Diltiazem HCl
Diltiazem HCl is a benzothiazepine derivative with vasodilating action due to its antagonism of the actions of the calcium ion in membrane functions.
| Trivial name | RG 83606 HCl; CRD-401 |
| Catalog Number | CSN10823 |
| Alternative Name(s) | RG 83606 HCl; CRD-401 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C22H27ClN2O4S |
| CAS# | 33286-22-5 |
| Purity | ≥99% |
| SMILES | CN(C)CCN1C2=CC=CC=C2S[C@@H](C3=CC=C(OC)C=C3)[C@@H](OC(C)=O)C1=O.Cl |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/diltiazem-hcl.html |