Daphnetin
Daphnetin is an inhibitor of EGFR, PKA and PKC with IC50 of 7.67 μM, 9.33 μM and 25.01 μM respectively. It derives from plants of the genus Daphne.
| Trivial name | / |
| Catalog Number | CSN10745 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C9H6O4 |
| CAS# | 486-35-1 |
| Purity | ≥99% |
| SMILES | O=C1C=CC2=C(O1)C(O)=C(O)C=C2 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/daphnetin.html |