Mianserin HCl
Mianserin HCl is inverse agonist of H1 receptor and can be act as a psychoactive agent of the tetracyclic antidepressant.
| Trivial name | ORG GB-94 HCl |
| Catalog Number | CSN10479 |
| Alternative Name(s) | ORG GB-94 HCl |
| Research Area | Neurological Disease |
| Molecular Formula | C18H21ClN2 |
| CAS# | 21535-47-7 |
| Purity | ≥99% |
| SMILES | CN(CC1)CC2N1C3=CC=CC=C3CC4=CC=CC=C24.Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/mianserin-hcl.html |