Betulonic Acid
Betulonic acid, a natural product isolated and purified from the branch of Eucalyptus globulus Labill., belongs to the pentacyclic triterpenic derivative class, has antitumor activities.
| Trivial name | Liquidambaric acid |
| Catalog Number | CSN10443 |
| Alternative Name(s) | Liquidambaric acid |
| Research Area | / |
| Molecular Formula | C30H46O3 |
| CAS# | 4481-62-3 |
| Purity | ≥99% |
| SMILES | O=C([C@](CC[C@@]1(C)[C@]2(C)CC[C@@]3([H])C4(C)C)(CC[C@H]5C(C)=C)[C@@]5([H])[C@@]1([H])CC[C@]2([H])[C@@]3(C)CCC4=O)O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/betulonic-acid.html |