Sorafenib
Sorafenib is a multikinase inhibitor of Raf-1, B-Raf and VEGFR-2 with IC50 of 6 nM, 22 nM and 90 nM in cell-free assays, respectively.
| Trivial name | BAY 43-9006 |
| Catalog Number | CSN10381 |
| Alternative Name(s) | BAY 43-9006 |
| Research Area | Cancer |
| Molecular Formula | C21H16ClF3N4O3 |
| CAS# | 284461-73-0 |
| Purity | ≥99% |
| SMILES | O=C(NC)C1=NC=CC(OC2=CC=C(NC(NC3=CC=C(Cl)C(C(F)(F)F)=C3)=O)C=C2)=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/sorafenib.html |