Avasimibe
Avasimibe is an ACAT inhibitor with IC50 of 3.3 μM, it also inhibits human P450 isoenzymes CYP2C9, CYP1A2 and CYP2C19 with IC50 of 2.9/13.9 and 26.5 μM, respectively.
| Trivial name | CI-1011 |
| Catalog Number | CSN10357 |
| Alternative Name(s) | CI-1011 |
| Research Area | Cancer |
| Molecular Formula | C29H43NO4S |
| CAS# | 166518-60-1 |
| Purity | ≥99% |
| SMILES | O=C(NS(=O)(OC1=C(C(C)C)C=CC=C1C(C)C)=O)CC2=C(C(C)C)C=C(C(C)C)C=C2C(C)C |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/avasimibe.html |