Auraptene
Auraptene is a natural product isolated and purified from the peel of Poncirus trifoliata with anti-tumor and anti-oxidant activity. Auraptene-mediated activation of JNK may contribute to the production of Aβ by promoting γ-secretase activity.
| Trivial name | 7-Geranyloxycoumarin |
| Catalog Number | CSN10356 |
| Alternative Name(s) | 7-Geranyloxycoumarin |
| Research Area | Cancer|Immunology/Inflammation |
| Molecular Formula | C19H22O3 |
| CAS# | 495-02-3 |
| Purity | ≥99% |
| SMILES | C/C(C)=C\CC/C(C)=C([H])/COC1=CC(O2)=C(C=CC2=O)C=C1 |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/auraptene.html |
