Thiamine HCl
Thiamine HCl is an essential coenzyme in carbohydrate metabolism, used as a vitamin supplement to the holidic medium and in bacterial growth medium.
| Trivial name | Vitamin-B1 |
| Catalog Number | CSN10069 |
| Alternative Name(s) | Vitamin-B1 |
| Research Area | Metabolic Disease |
| Molecular Formula | C12H18Cl2N4OS |
| CAS# | 67-03-8 |
| Purity | ≥99% |
| SMILES | CC1=C(CCO)SC=[N+]1CC2=CN=C(C)N=C2N.[H]Cl.[Cl-] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/thiamine-hcl.html |