Treprostinil
Rumodolinl, a analog of prostacyclin, is an agonist of IP receptor that used clinically to treat pulmonary arterial hypertension. It is a vasodilator with antithrombotic and anti-inflammatory properties.
| Trivial name | LRX 15; LRX-15; LRX15; BW 15AU; U-62840; Uniprost; Orenitram; Remodulin |
| Catalog Number | CSN23716 |
| Alternative Name(s) | LRX 15; LRX-15; LRX15; BW 15AU; U-62840; Uniprost; Orenitram; Remodulin |
| Research Area | / |
| Molecular Formula | C23H34O5 |
| CAS# | 81846-19-7 |
| Purity | ≥98% |
| SMILES | O=C(O)COC1=CC=CC2=C1C[C@]3([H])[C@]([C@@H](CC[C@@H](O)CCCCC)[C@H](O)C3)([H])C2 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/rumodolin.html |