L-Glucose
L-Glucose is the L-isomer of glucose and the enantiomer of the D-glucose. L-Glucose can not be used by living organisms directly and can be used as diagnostic aid.
| Trivial name | / |
| Catalog Number | CSN23668 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C6H12O6 |
| CAS# | 921-60-8 |
| Purity | ≥99% |
| SMILES | O=C[C@H]([C@@H]([C@H]([C@H](CO)O)O)O)O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/l-glucose.html |