L-Homoarginine HCl
L-Homoarginine HCl is an uncompetitive and specific inhibitor of alkaline phosphatase that inhibits human bone and liver alkaline phosphatases but has no effect on placental or intestinal isoenzymes.
Trivial name | H-HomoArg-OH.HCl;NSC 145416 |
Catalog Number | CSN23526 |
Alternative Name(s) | H-HomoArg-OH.HCl;NSC 145416 |
Research Area | / |
Molecular Formula | C7H17ClN4O2 |
CAS# | 1483-01-8 |
Purity | ≥98% |
SMILES | N[C@@H](CCCCNC(N)=N)C(O)=O.[H]Cl |
Size | 100mg |
Supplier Page | https://www.csnpharm.com/products/l-homoarginine-hcl.html |