Stiripentol
Stiripentol is an antiepileptic drug that can inhibit the synaptosomal uptake of GABA, increase the activation of GABAA receptors, it’s also a microsomal cytochrome P450 (CYP) isoforms CYP3A4, CYP1A2, and CYP2C19 inhibitor.
| Trivial name | BCX 2600 |
| Catalog Number | CSN23249 |
| Alternative Name(s) | BCX 2600 |
| Research Area | / |
| Molecular Formula | C14H18O3 |
| CAS# | 49763-96-4 |
| Purity | ≥99% |
| SMILES | CC(C)(C)C(O)/C=C/C1=CC=C(OCO2)C2=C1 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/stiripentol.html |
