Cefapirin Benzathine
Cephapirin Benzathine is the benzathine salt form of cephapirin with antibacterial activity. It binds to penicillin-binding proteins located on the inner membrane of the bacterial cell wall.
| Trivial name | Cephapirin Benzathine |
| Catalog Number | CSN23220 |
| Alternative Name(s) | Cephapirin Benzathine |
| Research Area | / |
| Molecular Formula | C50H54N8O12S4 |
| CAS# | 97468-37-6 |
| Purity | ≥98% |
| SMILES | O=C(C(N12)=C(COC(C)=O)CS[C@]2([H])[C@H](NC(CSC3=CC=NC=C3)=O)C1=O)O.O=C(C(N45)=C(COC(C)=O)CS[C@]5([H])[C@H](NC(CSC6=CC=NC=C6)=O)C4=O)O.C7(CNCCNCC8=CC=CC=C8)=CC=CC=C7 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/cefapirin-benzathine.html |
