β-NADP
β-NADP is an electron acceptor which acts as a key cofactor for electron transfer in the metabolism. Its oxidized form and reduced form are NADP+ and NADPH.
| Trivial name | NADP; Coenzyme II; TPN; Triphosphopyridine nucleotide |
| Catalog Number | CSN22935 |
| Alternative Name(s) | NADP; Coenzyme II; TPN; Triphosphopyridine nucleotide |
| Research Area | / |
| Molecular Formula | C21H28N7O17P3 |
| CAS# | 53-59-8 |
| Purity | ≥98% |
| SMILES | O=C(C1=C[N+]([C@@H]2O[C@H](COP(OP(OC[C@H]3O[C@@H](N4C5=NC=NC(N)=C5N=C4)[C@H](OP(O)(O)=O)[C@@H]3O)(O)=O)([O-])=O)[C@@H](O)[C@H]2O)=CC=C1)N |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/b-nadp.html |