Citicoline Sodium
Citicoline Sodium is an essential component of cell membrane phospholipids. Citicoline (CDP-choline or cytidinediphosphate choline; cytidine 5′-diphosphocholine) is a complex organic molecule composed of ribose, pyrophosphate, cytosine and choline. Citicoline is very water soluble and has a bioavailability of greater than 90%. Citicoline presented no mitogenic and chemotactic effects on hCMEC/D3; however, it significantly increased wound recovery, spheroid sprouting and strongly induced endothelial tube-like structure formation in Matrigel. Citicoline induced the expression of phospho-extracellular-signal regulated kinase (ERK)-1/2. It protects hCMEC/D3 against cell damage/apoptosis. Citicoline induces angiogenesis and improves survival of human brain microvessel endothelial cells through pathways involving p-ERK1/2, and IRS-1.
| Trivial name | CDP-choline |
| Catalog Number | CSN22595 |
| Alternative Name(s) | CDP-choline |
| Research Area | / |
| Molecular Formula | C14H25N4NaO11P2 |
| CAS# | 33818-15-4 |
| Purity | ≥98% |
| SMILES | O[C@H]1[C@@H](O[C@@H]([C@H]1O)COP(OP(OCC[N+](C)(C)C)([O-])=O)([O-])=O)N2C(N=C(C=C2)N)=O.[Na+] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/citicoline-sodium.html |
