(-)-Ambroxide
(-)-Ambroxide is a naturally occurring terpenoid and one of the key constituents responsible for the odor of ambergris. It is an autoxidation product of ambrein.Ambroxide is used in perfumery for creating ambergris notes and as a fixative.
| Trivial name | / |
| Catalog Number | CSN21952 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C16H28O |
| CAS# | 6790-58-5 |
| Purity | ≥98% |
| SMILES | C[C@]12CCCC(C)(C)[C@]1([H])CC[C@@]3(C)OCC[C@@]32[H] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/(-)-ambroxide.html |