Xanthinol Nicotinate
Xanthinol Nicotinate is a potent water-soluble derivative of niacin, it can be used as a vasodilator and also can be found in diet supplements.
| Trivial name | Complamin; Angioamin |
| Catalog Number | CSN21895 |
| Alternative Name(s) | Complamin; Angioamin |
| Research Area | / |
| Molecular Formula | C19H26N6O6 |
| CAS# | 437-74-1 |
| Purity | ≥98% |
| SMILES | O=C(C1=CC=CN=C1)O.O=C(N2C)N(C)C3=C(N(CC(O)CN(CCO)C)C=N3)C2=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/xanthinol-nicotinate.html |