Sodium Erythorbate
Sodium erythorbate is the sodium of erythorbic acid, a highly refined food-grade chemical closely related to vitamin C, synthesized from sugar, and used as a color fixative in preparing cured meats.
| Trivial name | D-Isoascorbate; Erythorbic acid sodium salt; Araboascorbic acid monosodium salt; Erbit N; Eribate N; Isoascorbate C sodium; Sodium isoascorbate |
| Catalog Number | CSN21619 |
| Alternative Name(s) | D-Isoascorbate; Erythorbic acid sodium salt; Araboascorbic acid monosodium salt; Erbit N; Eribate N; Isoascorbate C sodium; Sodium isoascorbate |
| Research Area | / |
| Molecular Formula | C6H7NaO6 |
| CAS# | 6381-77-7 |
| Purity | ≥99% |
| SMILES | O=C1C(O)=C([O-])[C@]([C@H](O)CO)([H])O1.[Na+] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/sodium-erythorbate.html |