L-Lysine HCl
L-Lysine HCl is an essential amino acid with various roles in calcium absorption, building muscle protein, recovering from surgery or sports injuries, as well as hormones, enzymes, and antibodies production.
| Trivial name | / |
| Catalog Number | CSN20787 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C6H15ClN2O2 |
| CAS# | 657-27-2 |
| Purity | ≥98% |
| SMILES | O=C(O)[C@@H](N)CCCCN.[H]Cl |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/l-lysine-hcl.html |
