O6-Benzylguanine
O6-Benzylguanine is an inactivator of O6-alkylguanine DNA alkyltransferase (AGT) and can prevent the repair of DNA damage induced by chemotherapeutics. It induces apoptosis and cell death.
| Trivial name | O6-BG; 6-(Benzyloxy)-7H-purin-2-amine |
| Catalog Number | CSN20781 |
| Alternative Name(s) | O6-BG; 6-(Benzyloxy)-7H-purin-2-amine |
| Research Area | / |
| Molecular Formula | C12H11N5O |
| CAS# | 19916-73-5 |
| Purity | ≥99% |
| SMILES | C3=NC1=C(C(=NC(=N1)N)OCC2=CC=CC=C2)[NH]3 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/o6-benzylguanine.html |
