TPI-1
TPI-1 is an SHP1 inhibitor with IC50 of 40 nM selectively increased SHP1 phospho-substrates (pLck-pY394, pZap70 and pSlp76) in Jurkat T cells but had little effects on pERK1/2 or pLck-pY505 regulated by phosphatases SHP2 or CD45, respectively. TPI-1 was shown to be more effective than sodium stibogluconate in SHP1 inhibition, immune cell activation and anti-tumor action.
| Trivial name | Tyrosine Phosphatase Inhibitor 1 |
| Catalog Number | CSN20445 |
| Alternative Name(s) | Tyrosine Phosphatase Inhibitor 1 |
| Research Area | Cancer |
| Molecular Formula | C12H6Cl2O2 |
| CAS# | 79756-69-7 |
| Purity | ≥98% |
| SMILES | O=C(C=C1)C(C2=CC(Cl)=CC=C2Cl)=CC1=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/tpi-1.html |