SU6668
SU6668 is a cell-permeable indolinone compound that acts as a potent ATP-competitive inhibitor against RTKs (receptor tyrosine kinases) Kit, PDGFRβ, VEGFR2 (Flk-1/KDR), FGFR1 activity in vitro (IC50 = 0.01, 0.1, 3.9, and 3.8 µM, respectively) and PDGF/VEGF/bFGF-mediated angiogenesis and tumor development. Although initially characterized as an RTK inhibitor, SU6668 is now also known to target ser/thr kinases Aurora A, Aurora B, TBK1 (NAK/T2K), and AMPK (IC50 = 0.85, 0.047, 1.4, and 1.8 µM, respectively), as well as non-receptor TKs Lyn and Yes (IC50 = 4.3 and 5.8 µM, respectively).
| Trivial name | NSC 702827; Orantinib; TSU 68; PDGFR Tyrosine Kinase Inhibitor VI |
| Catalog Number | CSN20031 |
| Alternative Name(s) | NSC 702827; Orantinib; TSU 68; PDGFR Tyrosine Kinase Inhibitor VI |
| Research Area | Cancer |
| Molecular Formula | C18H18N2O3 |
| CAS# | 210644-62-5 |
| Purity | ≥99% |
| SMILES | O=C(O)CCC1=C(C)NC(/C=C2C(NC3=C\2C=CC=C3)=O)=C1C |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/su6668.html |
