Ginsenoside Rb1
Ginsenoside Rb1, a natural product isolated and purified from the roots of Panax ginseng C. A. Mey. with anti-oxidative damage ,anti-renal interstitial fibrosis, immunostimulatory and anticancer effects, promotes neurotransmitter release by modulating phosphorylation of synapsins through a cAMP-dependent protein kinase pathway.
| Trivial name | Gypenoside III |
| Catalog Number | CSN19503 |
| Alternative Name(s) | Gypenoside III |
| Research Area | Cancer |
| Molecular Formula | C54H92O23 |
| CAS# | 41753-43-9 |
| Purity | ≥98% |
| SMILES | C[C@@]([C@@](CC1)(C)[C@@]2([H])[C@@]1([H])[C@@](CC/C=C(C)/C)(C)O[C@@H]3O[C@H](CO[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)(CC5)[C@@](C[C@H]2O)([H])[C@]6(C)[C@]5([H])C(C)(C)[C@@H](O[C@H](O[C@@H]7CO)[C@@H]([C@@H](O)[C@@H]7O)O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)CC6 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/ginsenoside-rb1.html |