Ginsenoside Rc
Ginsenoside Rc is a steroid glycoside, and a triterpene saponin found exclusively in the plant genus Panax (ginseng) with properties that inhibit or prevent tumors growth.
| Trivial name | Panaxoside Rc |
| Catalog Number | CSN19501 |
| Alternative Name(s) | Panaxoside Rc |
| Research Area | Cancer |
| Molecular Formula | C53H90O22 |
| CAS# | 11021-14-0 |
| Purity | ≥98% |
| SMILES | C[C@@]12[C@@]([H])([C@](C)([C@]3(CC2)[H])CC[C@@H](C3(C)C)O[C@@H]([C@@H]4O[C@@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)CO)O[C@@H]([C@H]([C@@H]4O)O)CO)C[C@H]([C@]6([C@]1(CC[C@@]6([C@@](C)(O[C@@H]7O[C@@H]([C@H]([C@@H]([C@H]7O)O)O)CO[C@@H]8O[C@H]([C@@H]([C@H]8O)O)CO)CC/C=C(C)\C)[H])C)[H])O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/ginsenoside-rc.html |