4-Aminoantipyrine
4-Aminoantipyrine is used as a reagent for glucose determination in the presence of peroxidase and phenol, it is a metabolite of aminopyrine with analgesic, anti-inflammatory and antipyretic properties.
| Trivial name | Ampyrone; NSC-60242; Metapirazone; Solnapyrin-A |
| Catalog Number | CSN19498 |
| Alternative Name(s) | Ampyrone; NSC-60242; Metapirazone; Solnapyrin-A |
| Research Area | / |
| Molecular Formula | C11H13N3O |
| CAS# | 83-07-8 |
| Purity | ≥99% |
| SMILES | O=C1N(C2=CC=CC=C2)N(C)C(C)=C1N |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/4-aminoantipyrine.html |