Sarpogrelate HCl
Sarpogrelate HCl is an antagonist of both 5HT2A and 5-HT2B receptors, which can block serotonin-induced platelet aggregation and treat diabetes mellitus, Buerger’s disease, Raynaud’s disease, coronary artery disease, angina pectoris and atherosclerosis.
| Trivial name | MCI 9042 |
| Catalog Number | CSN19474 |
| Alternative Name(s) | MCI 9042 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C24H32ClNO6 |
| CAS# | 135159-51-2 |
| Purity | ≥98% |
| SMILES | O=C(OC(COC1=CC=CC=C1CCC2=CC=CC(OC)=C2)CN(C)C)CCC(O)=O.[H]Cl |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/sarpogrelate-hcl.html |