Icariin
Icariin is a cGMP-specific PDE5 inhibitor with IC50 of 0.432 μM, 167-fold selective for PDE5 than PDE4 and exhibits multiple biological properties, including anti-inflammatory, neuroregulatory and neuroprotective activities. It is a major constituent of flavonoids from the Chinese medicinal herb Epimedium brevicornum..
| Trivial name | Ieariline |
| Catalog Number | CSN19464 |
| Alternative Name(s) | Ieariline |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C33H40O15 |
| CAS# | 489-32-7 |
| Purity | ≥98% |
| SMILES | O=C1C(O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)=C(C3=CC=C(OC)C=C3)OC4=C(C/C=C(C)\C)C(O[C@@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)CO)=CC(O)=C14 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/icariin.html |
