Resibufogenin
Resibufogenin, a natural product isolated and purified from the glandular body of Bufo bufo gargarizans Cantor, displays great potential as a chemotherapeutic agent in oncology.
| Trivial name | Bufogenin; NSC 90783 |
| Catalog Number | CSN19433 |
| Alternative Name(s) | Bufogenin; NSC 90783 |
| Research Area | Cancer |
| Molecular Formula | C24H32O4 |
| CAS# | 465-39-4 |
| Purity | ≥99% |
| SMILES | C[C@]([C@@H](C(C=C1)=COC1=O)C2)(CC[C@@]3([H])[C@@]4([H])CC[C@@]5([H])[C@@]3(CC[C@H](O)C5)C)[C@@]64[C@@H]2O6 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/resibufogenin.html |