Lobeline HCl
Lobeline HCl is a mixed agonist–antagonist of nAchR agonist and has multiple function such as VMAT2 ligand, inhibiting the reuptake of dopamine and serotonin, antagonist at μ-opioid receptors and P-glycoprotein inhibitor.
| Trivial name | α-Lobeline HCl; L-Lobeline HCl; (-)-Lobeline HCl |
| Catalog Number | CSN19428 |
| Alternative Name(s) | α-Lobeline HCl; L-Lobeline HCl; (-)-Lobeline HCl |
| Research Area | Neurological Disease |
| Molecular Formula | C22H28ClNO2 |
| CAS# | 134-63-4 |
| Purity | ≥99% |
| SMILES | O=C(C1=CC=CC=C1)C[C@@H]2N(C)[C@H](C[C@H](O)C3=CC=CC=C3)CCC2.[H]Cl |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/lobeline-hcl.html |
