Galanthamine Hydrobromide
Galanthamine hydrobromide is a natural occuring AchE inhibitor with IC50 value of 410nM and allosteric potentiator at neuronal nAchRs, used for the treatment of cognitive decline in mild to moderate Alzheimer’s disease and various other memory impairments.
| Trivial name | / |
| Catalog Number | CSN19398 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C17H22BrNO3 |
| CAS# | 1953-04-4 |
| Purity | ≥99% |
| SMILES | O[C@H]1C=C[C@@]23CCN(C)CC4=CC=C(OC)C(O[C@@]3([H])C1)=C24.Br |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/galanthamine-hydrobromide.html |