Mycophenolic Acid
Mycophenolic Acid is an an immunosuppresant agent with a potent inibition of IMPDH (inosine monophosphate dehydrogenase) and potent anti-proliferative activity, it can be isolated from several Penicillium species.
| Trivial name | MPA; NSC 129185 |
| Catalog Number | CSN19396 |
| Alternative Name(s) | MPA; NSC 129185 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C17H20O6 |
| CAS# | 24280-93-1 |
| Purity | ≥99% |
| SMILES | O=C(O)CC/C(C)=C/CC1=C(OC)C(C)=C2COC(C2=C1O)=O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/mycophenolic-acid.html |