Cytarabine
Cytarabine is an antimetabolic agent and DNA synthesis inhibitor with IC50 of 16 nM in wild-type CCRF-CEM cells.
| Trivial name | Cytosine β-D-arabinofuranoside; Cytosine beta-D-arabinofuranoside; Cytosine Arabinoside |
| Catalog Number | CSN19369 |
| Alternative Name(s) | Cytosine β-D-arabinofuranoside; Cytosine beta-D-arabinofuranoside; Cytosine Arabinoside |
| Research Area | Cancer |
| Molecular Formula | C9H13N3O5 |
| CAS# | 147-94-4 |
| Purity | ≥99% |
| SMILES | NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/cytarabine.html |