Indirubin
Indirubin is a purple 3,2- bisindole and a stable isomer of indigo isolated from Indigo naturalis (Apiaceae) with anti-inflammatory and anticancer activities.
| Trivial name | NSC 105327; C.I.73200; Couroupitine-B; Indigo Red |
| Catalog Number | CSN19364 |
| Alternative Name(s) | NSC 105327; C.I.73200; Couroupitine-B; Indigo Red |
| Research Area | Cancer |
| Molecular Formula | C16H10N2O2 |
| CAS# | 479-41-4 |
| Purity | ≥98% |
| SMILES | O=C1NC2=C(C=CC=C2)/C1=C3NC4=C(C=CC=C4)C\3=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/indirubin.html |
