THZ1 2HCl
THZ1 2HCl is a Cdk7 inhibitor (IC50s = 3.2-15.6 nM in vitro) that selectively targets a remote cysteine residue located outside of the classic kinase domain. THZ1 2HCl also targets Cdk12 kinase activity although at a higher concentration (IC50 = 250 nM).
| Trivial name | / |
| Catalog Number | CSN19264 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C31H30Cl3N7O2 |
| CAS# | 2095433-94-4 |
| Purity | ≥99% |
| SMILES | O=C(NC1=CC=CC(NC2=NC=C(Cl)C(C3=CNC4=C3C=CC=C4)=N2)=C1)C5=CC=C(NC(/C=C/CN(C)C)=O)C=C5.[H]Cl.[H]Cl |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/thz1-2hcl.html |
