2-Methoxyestradiol
2-methoxyestradiol is a natural metabolite of estrogen that is known to inhibit HIF-1 alpha with an IC50 of 0.71 ± 0.11 μM for the inhibition of BPAEC migration.
| Trivial name | NSC 659853; 2-ME2; 2-MeOE2 |
| Catalog Number | CSN19253 |
| Alternative Name(s) | NSC 659853; 2-ME2; 2-MeOE2 |
| Research Area | Cancer |
| Molecular Formula | C19H26O3 |
| CAS# | 362-07-2 |
| Purity | ≥99% |
| SMILES | OC(C(OC)=C1)=CC2=C1[C@@]3([H])CC[C@]4(C)[C@@H](O)CC[C@@]4([H])[C@]3([H])CC2 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/2-methoxyestradiol.html |
