CPI-455 HCl
CPI-455 HCl is an inhibitor of KDM5. It can elevate global levels of H3K4 trimethylation (H3K4me3) and decrease the number of DTPs in multiple cancer cell line models.
| Trivial name | / |
| Catalog Number | CSN19243 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C16H15ClN4O |
| CAS# | 2095432-28-1 |
| Purity | ≥98% |
| SMILES | N#CC1=C2NC(C3=CC=CC=C3)=C(C(C)C)C(N2N=C1)=O.[H]Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/cpi-455-hcl.html |