STO-609
STO-609 is a specific inhibitor of the Ca2+/Calmodulin-dependent protein kinase kinase (CaM-KK) that inhibits the activities of recombinant CaM-KKα and CaM-KKβ isoforms, with Ki values of 80 and 15 ng/mL, respectively, and also inhibits their autophosphorylation activities.
| Trivial name | / |
| Catalog Number | CSN19242 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C19H10N2O3 |
| CAS# | 52029-86-4 |
| Purity | ≥98% |
| SMILES | O=C(C1=C2C3=C(C4=NC5=CC=CC=C5N4C(C3=CC=C2)=O)C=C1)O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/sto-609.html |
