CX-6258 HCl
CX-6258 HCl is a potent, orally efficacious pan-Pim kinase inhibitor with IC50 of 5 nM, 25 nM and 16 nM for Pim1, Pim2, and Pim3, respectively.
| Trivial name | / |
| Catalog Number | CSN19180 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C26H25Cl2N3O3 |
| CAS# | 1353859-00-3 |
| Purity | ≥98% |
| SMILES | O=C1NC2=C(C=C(Cl)C=C2)/C1=C\C3=CC=C(C4=CC=CC(C(N5CCN(C)CCC5)=O)=C4)O3.[H]Cl |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/cx-6258-hcl.html |